C20H35N3 — CID 52983252
(1S,2R,7R,9R,10R)-1-piperidin-2-yl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane (PubChem CID 52983252) has the molecular formula C20H35N3 and a molecular weight of 317.52 g/mol. Its IUPAC name is (1S,2R,7R,9R,10R)-1-piperidin-2-yl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane.
| Compound Name | (1S,2R,7R,9R,10R)-1-piperidin-2-yl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane |
|---|---|
| PubChem CID | 52983252 |
| Molecular Formula | C20H35N3 |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.28 |
| IUPAC Name | (1S,2R,7R,9R,10R)-1-piperidin-2-yl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane |
| SMILES | C1CCC([C@@]23C[C@@H](C[C@H]4CCCN[C@H]42)[C@H]2CCCCN2C3)NC1 |
| InChI | InChI=1S/C20H35N3/c1-3-9-21-18(8-1)20-13-16(12-15-6-5-10-22-19(15)20)17-7-2-4-11-23(17)14-20/h15-19,21-22H,1-14H2/t15-,16-,17-,18?,19-,20+/m1/s1 |
| InChIKey | YUKCLPPRYNXRAF-CCYWDIDXSA-N |
| XLogP | 2.76 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |