C15H15BrClN5O — CID 52995077
2-[4-(4-bromophenyl)quinazolin-2-yl]guanidine;hydrate;hydrochloride (PubChem CID 52995077) has the molecular formula C15H15BrClN5O and a molecular weight of 396.68 g/mol. Its IUPAC name is 2-[4-(4-bromophenyl)quinazolin-2-yl]guanidine;hydrate;hydrochloride.
| Compound Name | 2-[4-(4-bromophenyl)quinazolin-2-yl]guanidine;hydrate;hydrochloride |
|---|---|
| PubChem CID | 52995077 |
| Molecular Formula | C15H15BrClN5O |
| Molecular Weight | 396.68 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | 2-[4-(4-bromophenyl)quinazolin-2-yl]guanidine;hydrate;hydrochloride |
| SMILES | Cl.NC(N)=Nc1nc(-c2ccc(Br)cc2)c2ccccc2n1.O |
| InChI | InChI=1S/C15H12BrN5.ClH.H2O/c16-10-7-5-9(6-8-10)13-11-3-1-2-4-12(11)19-15(20-13)21-14(17)18;;/h1-8H,(H4,17,18,19,20,21);1H;1H2 |
| InChIKey | IKDYKNZYNGHCCB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 121.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.68 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|