C16H16ClN5O — CID 91992817
2-(5-methoxy-4-phenylquinazolin-2-yl)guanidine;hydrochloride (PubChem CID 91992817) has the molecular formula C16H16ClN5O and a molecular weight of 329.79 g/mol. Its IUPAC name is 2-(5-methoxy-4-phenylquinazolin-2-yl)guanidine;hydrochloride.
| Compound Name | 2-(5-methoxy-4-phenylquinazolin-2-yl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 91992817 |
| Molecular Formula | C16H16ClN5O |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2-(5-methoxy-4-phenylquinazolin-2-yl)guanidine;hydrochloride |
| SMILES | COc1cccc2nc(N=C(N)N)nc(-c3ccccc3)c12.Cl |
| InChI | InChI=1S/C16H15N5O.ClH/c1-22-12-9-5-8-11-13(12)14(10-6-3-2-4-7-10)20-16(19-11)21-15(17)18;/h2-9H,1H3,(H4,17,18,19,20,21);1H |
| InChIKey | DIKZIMJEDVHQGQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|