C17H17N3O2 — CID 53014628
1-N-methyl-6-N-phenyl-2,3-dihydroindole-1,6-dicarboxamide (PubChem CID 53014628) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 1-N-methyl-6-N-phenyl-2,3-dihydroindole-1,6-dicarboxamide.
| Compound Name | 1-N-methyl-6-N-phenyl-2,3-dihydroindole-1,6-dicarboxamide |
|---|---|
| PubChem CID | 53014628 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 1-N-methyl-6-N-phenyl-2,3-dihydroindole-1,6-dicarboxamide |
| SMILES | CNC(=O)N1CCc2ccc(C(=O)Nc3ccccc3)cc21 |
| InChI | InChI=1S/C17H17N3O2/c1-18-17(22)20-10-9-12-7-8-13(11-15(12)20)16(21)19-14-5-3-2-4-6-14/h2-8,11H,9-10H2,1H3,(H,18,22)(H,19,21) |
| InChIKey | HCGNUROAQOODEA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |