C17H22N4O — CID 53016678
N,8-dimethyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamide (PubChem CID 53016678) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is N,8-dimethyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamide.
| Compound Name | N,8-dimethyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 53016678 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | N,8-dimethyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamide |
| SMILES | CNC(=O)c1cc(N2CCN(C)CC2)nc2c(C)cccc12 |
| InChI | InChI=1S/C17H22N4O/c1-12-5-4-6-13-14(17(22)18-2)11-15(19-16(12)13)21-9-7-20(3)8-10-21/h4-6,11H,7-10H2,1-3H3,(H,18,22) |
| InChIKey | BYMWNCNMGWAXAX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |