C18H17ClN2O4S — CID 5303804
1-(4-chloro-2,5-dimethoxyphenyl)sulfonyl-4-methyl-2-phenylimidazole (PubChem CID 5303804) has the molecular formula C18H17ClN2O4S and a molecular weight of 392.86 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dimethoxyphenyl)sulfonyl-4-methyl-2-phenylimidazole.
| Compound Name | 1-(4-chloro-2,5-dimethoxyphenyl)sulfonyl-4-methyl-2-phenylimidazole |
|---|---|
| PubChem CID | 5303804 |
| Molecular Formula | C18H17ClN2O4S |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 1-(4-chloro-2,5-dimethoxyphenyl)sulfonyl-4-methyl-2-phenylimidazole |
| SMILES | COc1cc(S(=O)(=O)n2cc(C)nc2-c2ccccc2)c(OC)cc1Cl |
| InChI | InChI=1S/C18H17ClN2O4S/c1-12-11-21(18(20-12)13-7-5-4-6-8-13)26(22,23)17-10-15(24-2)14(19)9-16(17)25-3/h4-11H,1-3H3 |
| InChIKey | FWSCODRNSJLXIA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |