C21H24N2O4 — CID 53057438
N-(3,5-dimethoxyphenyl)-2-(3,3,5-trimethyl-2-oxoindol-1-yl)acetamide (PubChem CID 53057438) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-2-(3,3,5-trimethyl-2-oxoindol-1-yl)acetamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-2-(3,3,5-trimethyl-2-oxoindol-1-yl)acetamide |
|---|---|
| PubChem CID | 53057438 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-2-(3,3,5-trimethyl-2-oxoindol-1-yl)acetamide |
| SMILES | COc1cc(NC(=O)CN2C(=O)C(C)(C)c3cc(C)ccc32)cc(OC)c1 |
| InChI | InChI=1S/C21H24N2O4/c1-13-6-7-18-17(8-13)21(2,3)20(25)23(18)12-19(24)22-14-9-15(26-4)11-16(10-14)27-5/h6-11H,12H2,1-5H3,(H,22,24) |
| InChIKey | CHAVYHKKTVGFHQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |