C25H19ClN4O3S — CID 53072943
N-(3-chlorophenyl)-2-[4,6-dioxo-5-(2-phenylethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]acetamide (PubChem CID 53072943) has the molecular formula C25H19ClN4O3S and a molecular weight of 490.97 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[4,6-dioxo-5-(2-phenylethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[4,6-dioxo-5-(2-phenylethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]acetamide |
|---|---|
| PubChem CID | 53072943 |
| Molecular Formula | C25H19ClN4O3S |
| Molecular Weight | 490.97 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | N-(3-chlorophenyl)-2-[4,6-dioxo-5-(2-phenylethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]acetamide |
| SMILES | O=C(Cn1c(=O)n(CCc2ccccc2)c(=O)c2sc3ncccc3c21)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C25H19ClN4O3S/c26-17-8-4-9-18(14-17)28-20(31)15-30-21-19-10-5-12-27-23(19)34-22(21)24(32)29(25(30)33)13-11-16-6-2-1-3-7-16/h1-10,12,14H,11,13,15H2,(H,28,31) |
| InChIKey | GCTUONFPRNUPQE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.97 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |