C24H24N4O4S — CID 95071752
2-[4,6-dioxo-5-[[(2S)-oxolan-2-yl]methyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]-N-(3-ethylphenyl)acetamide (PubChem CID 95071752) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is 2-[4,6-dioxo-5-[[(2S)-oxolan-2-yl]methyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]-N-(3-ethylphenyl)acetamide.
| Compound Name | 2-[4,6-dioxo-5-[[(2S)-oxolan-2-yl]methyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]-N-(3-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 95071752 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 2-[4,6-dioxo-5-[[(2S)-oxolan-2-yl]methyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]-N-(3-ethylphenyl)acetamide |
| SMILES | CCc1cccc(NC(=O)Cn2c(=O)n(C[C@@H]3CCCO3)c(=O)c3sc4ncccc4c32)c1 |
| InChI | InChI=1S/C24H24N4O4S/c1-2-15-6-3-7-16(12-15)26-19(29)14-27-20-18-9-4-10-25-22(18)33-21(20)23(30)28(24(27)31)13-17-8-5-11-32-17/h3-4,6-7,9-10,12,17H,2,5,8,11,13-14H2,1H3,(H,26,29)/t17-/m0/s1 |
| InChIKey | GNWRHIWSHLRHBY-KRWDZBQOSA-N |
| XLogP | 3.15 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |