C22H26N4O4S — CID 93065902
N-cyclohexyl-2-[4,6-dioxo-5-[[(2S)-oxolan-2-yl]methyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]acetamide (PubChem CID 93065902) has the molecular formula C22H26N4O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is N-cyclohexyl-2-[4,6-dioxo-5-[[(2S)-oxolan-2-yl]methyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]acetamide.
| Compound Name | N-cyclohexyl-2-[4,6-dioxo-5-[[(2S)-oxolan-2-yl]methyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]acetamide |
|---|---|
| PubChem CID | 93065902 |
| Molecular Formula | C22H26N4O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | N-cyclohexyl-2-[4,6-dioxo-5-[[(2S)-oxolan-2-yl]methyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]acetamide |
| SMILES | O=C(Cn1c(=O)n(C[C@@H]2CCCO2)c(=O)c2sc3ncccc3c21)NC1CCCCC1 |
| InChI | InChI=1S/C22H26N4O4S/c27-17(24-14-6-2-1-3-7-14)13-25-18-16-9-4-10-23-20(16)31-19(18)21(28)26(22(25)29)12-15-8-5-11-30-15/h4,9-10,14-15H,1-3,5-8,11-13H2,(H,24,27)/t15-/m0/s1 |
| InChIKey | UOZJVGGXPNQTAD-HNNXBMFYSA-N |
| XLogP | 2.40 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |