C23H22N4O5S — CID 95071726
2-[4,6-dioxo-5-[[(2S)-oxolan-2-yl]methyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]-N-(3-methoxyphenyl)acetamide (PubChem CID 95071726) has the molecular formula C23H22N4O5S and a molecular weight of 466.52 g/mol. Its IUPAC name is 2-[4,6-dioxo-5-[[(2S)-oxolan-2-yl]methyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[4,6-dioxo-5-[[(2S)-oxolan-2-yl]methyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 95071726 |
| Molecular Formula | C23H22N4O5S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 2-[4,6-dioxo-5-[[(2S)-oxolan-2-yl]methyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)Cn2c(=O)n(C[C@@H]3CCCO3)c(=O)c3sc4ncccc4c32)c1 |
| InChI | InChI=1S/C23H22N4O5S/c1-31-15-6-2-5-14(11-15)25-18(28)13-26-19-17-8-3-9-24-21(17)33-20(19)22(29)27(23(26)30)12-16-7-4-10-32-16/h2-3,5-6,8-9,11,16H,4,7,10,12-13H2,1H3,(H,25,28)/t16-/m0/s1 |
| InChIKey | DGOAQLUDPDILNB-INIZCTEOSA-N |
| XLogP | 2.60 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |