C24H24N4O5S — CID 95071746
2-[4,6-dioxo-5-[[(2S)-oxolan-2-yl]methyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]-N-(2-ethoxyphenyl)acetamide (PubChem CID 95071746) has the molecular formula C24H24N4O5S and a molecular weight of 480.55 g/mol. Its IUPAC name is 2-[4,6-dioxo-5-[[(2S)-oxolan-2-yl]methyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]-N-(2-ethoxyphenyl)acetamide.
| Compound Name | 2-[4,6-dioxo-5-[[(2S)-oxolan-2-yl]methyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]-N-(2-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 95071746 |
| Molecular Formula | C24H24N4O5S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 2-[4,6-dioxo-5-[[(2S)-oxolan-2-yl]methyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]-N-(2-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccccc1NC(=O)Cn1c(=O)n(C[C@@H]2CCCO2)c(=O)c2sc3ncccc3c21 |
| InChI | InChI=1S/C24H24N4O5S/c1-2-32-18-10-4-3-9-17(18)26-19(29)14-27-20-16-8-5-11-25-22(16)34-21(20)23(30)28(24(27)31)13-15-7-6-12-33-15/h3-5,8-11,15H,2,6-7,12-14H2,1H3,(H,26,29)/t15-/m0/s1 |
| InChIKey | ILPMGXFMDBSKTL-HNNXBMFYSA-N |
| XLogP | 2.99 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |