C23H22N4O4S — CID 53072971
2-[4,6-dioxo-5-(oxolan-2-ylmethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]-N-(4-methylphenyl)acetamide (PubChem CID 53072971) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is 2-[4,6-dioxo-5-(oxolan-2-ylmethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4,6-dioxo-5-(oxolan-2-ylmethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 53072971 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 2-[4,6-dioxo-5-(oxolan-2-ylmethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2c(=O)n(CC3CCCO3)c(=O)c3sc4ncccc4c32)cc1 |
| InChI | InChI=1S/C23H22N4O4S/c1-14-6-8-15(9-7-14)25-18(28)13-26-19-17-5-2-10-24-21(17)32-20(19)22(29)27(23(26)30)12-16-4-3-11-31-16/h2,5-10,16H,3-4,11-13H2,1H3,(H,25,28) |
| InChIKey | GNVARXXFAJVZEA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |