C21H24N4O4S — CID 53006723
N-cyclopentyl-2-[4,6-dioxo-5-(oxolan-2-ylmethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]acetamide (PubChem CID 53006723) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is N-cyclopentyl-2-[4,6-dioxo-5-(oxolan-2-ylmethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]acetamide.
| Compound Name | N-cyclopentyl-2-[4,6-dioxo-5-(oxolan-2-ylmethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]acetamide |
|---|---|
| PubChem CID | 53006723 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | N-cyclopentyl-2-[4,6-dioxo-5-(oxolan-2-ylmethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-yl]acetamide |
| SMILES | O=C(Cn1c(=O)n(CC2CCCO2)c(=O)c2sc3ncccc3c21)NC1CCCC1 |
| InChI | InChI=1S/C21H24N4O4S/c26-16(23-13-5-1-2-6-13)12-24-17-15-8-3-9-22-19(15)30-18(17)20(27)25(21(24)28)11-14-7-4-10-29-14/h3,8-9,13-14H,1-2,4-7,10-12H2,(H,23,26) |
| InChIKey | KQESFPFNOQSDOC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |