C15H13N3O3S — CID 53078621
(E)-3-(furan-2-yl)-N-[2-methyl-5-(5-methyl-1,2,4-oxadiazol-3-yl)thiophen-3-yl]prop-2-enamide (PubChem CID 53078621) has the molecular formula C15H13N3O3S and a molecular weight of 315.35 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-[2-methyl-5-(5-methyl-1,2,4-oxadiazol-3-yl)thiophen-3-yl]prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-[2-methyl-5-(5-methyl-1,2,4-oxadiazol-3-yl)thiophen-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 53078621 |
| Molecular Formula | C15H13N3O3S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-[2-methyl-5-(5-methyl-1,2,4-oxadiazol-3-yl)thiophen-3-yl]prop-2-enamide |
| SMILES | Cc1nc(-c2cc(NC(=O)/C=C/c3ccco3)c(C)s2)no1 |
| InChI | InChI=1S/C15H13N3O3S/c1-9-12(8-13(22-9)15-16-10(2)21-18-15)17-14(19)6-5-11-4-3-7-20-11/h3-8H,1-2H3,(H,17,19)/b6-5+ |
| InChIKey | NXFMCHVLZOTDRW-AATRIKPKSA-N |
| XLogP | 3.66 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|