C20H14ClF2N5OS — CID 53079989
N-(3-chloro-4-fluorophenyl)-4-(4-fluorophenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide (PubChem CID 53079989) has the molecular formula C20H14ClF2N5OS and a molecular weight of 445.88 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-4-(4-fluorophenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-4-(4-fluorophenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide |
|---|---|
| PubChem CID | 53079989 |
| Molecular Formula | C20H14ClF2N5OS |
| Molecular Weight | 445.88 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-4-(4-fluorophenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)N1CCc2c(sc3nc(-c4ccc(F)cc4)nn23)C1 |
| InChI | InChI=1S/C20H14ClF2N5OS/c21-14-9-13(5-6-15(14)23)24-19(29)27-8-7-16-17(10-27)30-20-25-18(26-28(16)20)11-1-3-12(22)4-2-11/h1-6,9H,7-8,10H2,(H,24,29) |
| InChIKey | ATYJBCQSKYGXFO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.88 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |