C22H20ClN5OS — CID 53080040
N-(5-chloro-2-methylphenyl)-4-(4-methylphenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide (PubChem CID 53080040) has the molecular formula C22H20ClN5OS and a molecular weight of 437.96 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-4-(4-methylphenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-4-(4-methylphenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide |
|---|---|
| PubChem CID | 53080040 |
| Molecular Formula | C22H20ClN5OS |
| Molecular Weight | 437.96 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-4-(4-methylphenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide |
| SMILES | Cc1ccc(-c2nc3sc4c(n3n2)CCN(C(=O)Nc2cc(Cl)ccc2C)C4)cc1 |
| InChI | InChI=1S/C22H20ClN5OS/c1-13-3-6-15(7-4-13)20-25-22-28(26-20)18-9-10-27(12-19(18)30-22)21(29)24-17-11-16(23)8-5-14(17)2/h3-8,11H,9-10,12H2,1-2H3,(H,24,29) |
| InChIKey | JMMSWTMFIVQJMZ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.96 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |