C17H19N5O2S — CID 53080129
N-(2-methoxyethyl)-4-phenyl-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide (PubChem CID 53080129) has the molecular formula C17H19N5O2S and a molecular weight of 357.44 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-phenyl-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide.
| Compound Name | N-(2-methoxyethyl)-4-phenyl-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide |
|---|---|
| PubChem CID | 53080129 |
| Molecular Formula | C17H19N5O2S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N-(2-methoxyethyl)-4-phenyl-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide |
| SMILES | COCCNC(=O)N1CCc2c(sc3nc(-c4ccccc4)nn23)C1 |
| InChI | InChI=1S/C17H19N5O2S/c1-24-10-8-18-16(23)21-9-7-13-14(11-21)25-17-19-15(20-22(13)17)12-5-3-2-4-6-12/h2-6H,7-11H2,1H3,(H,18,23) |
| InChIKey | UTNLYYLXXXFVRZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|