C21H18ClN5OS — CID 53080027
N-(4-chlorophenyl)-4-(4-methylphenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide (PubChem CID 53080027) has the molecular formula C21H18ClN5OS and a molecular weight of 423.93 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-(4-methylphenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide.
| Compound Name | N-(4-chlorophenyl)-4-(4-methylphenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide |
|---|---|
| PubChem CID | 53080027 |
| Molecular Formula | C21H18ClN5OS |
| Molecular Weight | 423.93 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | N-(4-chlorophenyl)-4-(4-methylphenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide |
| SMILES | Cc1ccc(-c2nc3sc4c(n3n2)CCN(C(=O)Nc2ccc(Cl)cc2)C4)cc1 |
| InChI | InChI=1S/C21H18ClN5OS/c1-13-2-4-14(5-3-13)19-24-21-27(25-19)17-10-11-26(12-18(17)29-21)20(28)23-16-8-6-15(22)7-9-16/h2-9H,10-12H2,1H3,(H,23,28) |
| InChIKey | HTSYJAIEJRDHDQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.93 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |