C23H23N5OS — CID 53080026
N-(4-ethylphenyl)-4-(4-methylphenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide (PubChem CID 53080026) has the molecular formula C23H23N5OS and a molecular weight of 417.54 g/mol. Its IUPAC name is N-(4-ethylphenyl)-4-(4-methylphenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide.
| Compound Name | N-(4-ethylphenyl)-4-(4-methylphenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide |
|---|---|
| PubChem CID | 53080026 |
| Molecular Formula | C23H23N5OS |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | N-(4-ethylphenyl)-4-(4-methylphenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide |
| SMILES | CCc1ccc(NC(=O)N2CCc3c(sc4nc(-c5ccc(C)cc5)nn34)C2)cc1 |
| InChI | InChI=1S/C23H23N5OS/c1-3-16-6-10-18(11-7-16)24-22(29)27-13-12-19-20(14-27)30-23-25-21(26-28(19)23)17-8-4-15(2)5-9-17/h4-11H,3,12-14H2,1-2H3,(H,24,29) |
| InChIKey | RUBIXGOQCYCKEY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |