C17H16FN5O — CID 5308607
5-amino-N-benzyl-1-[(4-fluorophenyl)methyl]triazole-4-carboxamide (PubChem CID 5308607) has the molecular formula C17H16FN5O and a molecular weight of 325.35 g/mol. Its IUPAC name is 5-amino-N-benzyl-1-[(4-fluorophenyl)methyl]triazole-4-carboxamide.
| Compound Name | 5-amino-N-benzyl-1-[(4-fluorophenyl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 5308607 |
| Molecular Formula | C17H16FN5O |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 5-amino-N-benzyl-1-[(4-fluorophenyl)methyl]triazole-4-carboxamide |
| SMILES | Nc1c(C(=O)NCc2ccccc2)nnn1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C17H16FN5O/c18-14-8-6-13(7-9-14)11-23-16(19)15(21-22-23)17(24)20-10-12-4-2-1-3-5-12/h1-9H,10-11,19H2,(H,20,24) |
| InChIKey | BOYRQPFRSOYQOX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |