C17H10ClF2NO3S2 — CID 53124627
5-(4-chlorophenyl)sulfonyl-N-(2,4-difluorophenyl)thiophene-2-carboxamide (PubChem CID 53124627) has the molecular formula C17H10ClF2NO3S2 and a molecular weight of 413.85 g/mol. Its IUPAC name is 5-(4-chlorophenyl)sulfonyl-N-(2,4-difluorophenyl)thiophene-2-carboxamide.
| Compound Name | 5-(4-chlorophenyl)sulfonyl-N-(2,4-difluorophenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 53124627 |
| Molecular Formula | C17H10ClF2NO3S2 |
| Molecular Weight | 413.85 g/mol |
| Exact Mass | 412.98 |
| IUPAC Name | 5-(4-chlorophenyl)sulfonyl-N-(2,4-difluorophenyl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)c1ccc(S(=O)(=O)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C17H10ClF2NO3S2/c18-10-1-4-12(5-2-10)26(23,24)16-8-7-15(25-16)17(22)21-14-6-3-11(19)9-13(14)20/h1-9H,(H,21,22) |
| InChIKey | YNWFDFXZBNJQAB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.85 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |