C16H21N5O3S2 — CID 53142656
1-ethyl-N-(pyridin-4-ylmethyl)-3-thiomorpholin-4-ylsulfonylpyrazole-4-carboxamide (PubChem CID 53142656) has the molecular formula C16H21N5O3S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 1-ethyl-N-(pyridin-4-ylmethyl)-3-thiomorpholin-4-ylsulfonylpyrazole-4-carboxamide.
| Compound Name | 1-ethyl-N-(pyridin-4-ylmethyl)-3-thiomorpholin-4-ylsulfonylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 53142656 |
| Molecular Formula | C16H21N5O3S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 1-ethyl-N-(pyridin-4-ylmethyl)-3-thiomorpholin-4-ylsulfonylpyrazole-4-carboxamide |
| SMILES | CCn1cc(C(=O)NCc2ccncc2)c(S(=O)(=O)N2CCSCC2)n1 |
| InChI | InChI=1S/C16H21N5O3S2/c1-2-20-12-14(15(22)18-11-13-3-5-17-6-4-13)16(19-20)26(23,24)21-7-9-25-10-8-21/h3-6,12H,2,7-11H2,1H3,(H,18,22) |
| InChIKey | IXPMSOLMECOQFJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |