C20H33NO4S — CID 531450
methyl 2-(3-cyclopentylpropanoylamino)-3-(3-cyclopentylpropanoylsulfanyl)propanoate (PubChem CID 531450) has the molecular formula C20H33NO4S and a molecular weight of 383.55 g/mol. Its IUPAC name is methyl 2-(3-cyclopentylpropanoylamino)-3-(3-cyclopentylpropanoylsulfanyl)propanoate.
| Compound Name | methyl 2-(3-cyclopentylpropanoylamino)-3-(3-cyclopentylpropanoylsulfanyl)propanoate |
|---|---|
| PubChem CID | 531450 |
| Molecular Formula | C20H33NO4S |
| Molecular Weight | 383.55 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | methyl 2-(3-cyclopentylpropanoylamino)-3-(3-cyclopentylpropanoylsulfanyl)propanoate |
| SMILES | COC(=O)C(CSC(=O)CCC1CCCC1)NC(=O)CCC1CCCC1 |
| InChI | InChI=1S/C20H33NO4S/c1-25-20(24)17(21-18(22)12-10-15-6-2-3-7-15)14-26-19(23)13-11-16-8-4-5-9-16/h15-17H,2-14H2,1H3,(H,21,22) |
| InChIKey | NEJJDJWZYHXFKY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|