C21H32O5 — CID 5316684
methyl 2-[(1S,3R,5S,9R,10S,13R)-3-ethenyl-1,3,9-trimethyl-7-oxo-2,6-dioxatricyclo[7.3.1.05,13]tridecan-10-yl]-2-methylpropanoate (PubChem CID 5316684) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is methyl 2-[(1S,3R,5S,9R,10S,13R)-3-ethenyl-1,3,9-trimethyl-7-oxo-2,6-dioxatricyclo[7.3.1.05,13]tridecan-10-yl]-2-methylpropanoate.
| Compound Name | methyl 2-[(1S,3R,5S,9R,10S,13R)-3-ethenyl-1,3,9-trimethyl-7-oxo-2,6-dioxatricyclo[7.3.1.05,13]tridecan-10-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 5316684 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | methyl 2-[(1S,3R,5S,9R,10S,13R)-3-ethenyl-1,3,9-trimethyl-7-oxo-2,6-dioxatricyclo[7.3.1.05,13]tridecan-10-yl]-2-methylpropanoate |
| SMILES | C=C[C@@]1(C)C[C@@H]2OC(=O)C[C@]3(C)[C@@H](C(C)(C)C(=O)OC)CC[C@](C)(O1)[C@@H]23 |
| InChI | InChI=1S/C21H32O5/c1-8-19(4)11-13-16-20(5,12-15(22)25-13)14(9-10-21(16,6)26-19)18(2,3)17(23)24-7/h8,13-14,16H,1,9-12H2,2-7H3/t13-,14+,16-,19-,20+,21-/m0/s1 |
| InChIKey | SJYXNXQXSGXBCQ-CMKJHORQSA-N |
| XLogP | 3.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|