C21H16F2N4O3S — CID 53183899
12-(3,5-difluorophenyl)sulfonyl-5-phenyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 53183899) has the molecular formula C21H16F2N4O3S and a molecular weight of 442.45 g/mol. Its IUPAC name is 12-(3,5-difluorophenyl)sulfonyl-5-phenyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 12-(3,5-difluorophenyl)sulfonyl-5-phenyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 53183899 |
| Molecular Formula | C21H16F2N4O3S |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 12-(3,5-difluorophenyl)sulfonyl-5-phenyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | O=c1c2c(nc3cc(-c4ccccc4)[nH]n13)CN(S(=O)(=O)c1cc(F)cc(F)c1)CC2 |
| InChI | InChI=1S/C21H16F2N4O3S/c22-14-8-15(23)10-16(9-14)31(29,30)26-7-6-17-19(12-26)24-20-11-18(25-27(20)21(17)28)13-4-2-1-3-5-13/h1-5,8-11,25H,6-7,12H2 |
| InChIKey | YTMQPKMRRGYMCW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |