C14H23N5O2S — CID 53185789
N-[1-[6-(dimethylamino)pyrimidin-4-yl]piperidin-3-yl]cyclopropanesulfonamide (PubChem CID 53185789) has the molecular formula C14H23N5O2S and a molecular weight of 325.44 g/mol. Its IUPAC name is N-[1-[6-(dimethylamino)pyrimidin-4-yl]piperidin-3-yl]cyclopropanesulfonamide.
| Compound Name | N-[1-[6-(dimethylamino)pyrimidin-4-yl]piperidin-3-yl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 53185789 |
| Molecular Formula | C14H23N5O2S |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | N-[1-[6-(dimethylamino)pyrimidin-4-yl]piperidin-3-yl]cyclopropanesulfonamide |
| SMILES | CN(C)c1cc(N2CCCC(NS(=O)(=O)C3CC3)C2)ncn1 |
| InChI | InChI=1S/C14H23N5O2S/c1-18(2)13-8-14(16-10-15-13)19-7-3-4-11(9-19)17-22(20,21)12-5-6-12/h8,10-12,17H,3-7,9H2,1-2H3 |
| InChIKey | VDYLANLYIOYTRL-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |