C17H20N4O4 — CID 53185889
furan-2-yl-[3-(6-morpholin-4-ylpyrimidin-4-yl)oxypyrrolidin-1-yl]methanone (PubChem CID 53185889) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is furan-2-yl-[3-(6-morpholin-4-ylpyrimidin-4-yl)oxypyrrolidin-1-yl]methanone.
| Compound Name | furan-2-yl-[3-(6-morpholin-4-ylpyrimidin-4-yl)oxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 53185889 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | furan-2-yl-[3-(6-morpholin-4-ylpyrimidin-4-yl)oxypyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccco1)N1CCC(Oc2cc(N3CCOCC3)ncn2)C1 |
| InChI | InChI=1S/C17H20N4O4/c22-17(14-2-1-7-24-14)21-4-3-13(11-21)25-16-10-15(18-12-19-16)20-5-8-23-9-6-20/h1-2,7,10,12-13H,3-6,8-9,11H2 |
| InChIKey | SYFYZXBJYWQDHF-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 80.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |