C18H18ClN7OS — CID 53190108
1-(3-chlorophenyl)-3-[1-(5-thiomorpholin-4-ylpyrimidin-4-yl)pyrazol-4-yl]urea (PubChem CID 53190108) has the molecular formula C18H18ClN7OS and a molecular weight of 415.91 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[1-(5-thiomorpholin-4-ylpyrimidin-4-yl)pyrazol-4-yl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[1-(5-thiomorpholin-4-ylpyrimidin-4-yl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 53190108 |
| Molecular Formula | C18H18ClN7OS |
| Molecular Weight | 415.91 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[1-(5-thiomorpholin-4-ylpyrimidin-4-yl)pyrazol-4-yl]urea |
| SMILES | O=C(Nc1cccc(Cl)c1)Nc1cnn(-c2ncncc2N2CCSCC2)c1 |
| InChI | InChI=1S/C18H18ClN7OS/c19-13-2-1-3-14(8-13)23-18(27)24-15-9-22-26(11-15)17-16(10-20-12-21-17)25-4-6-28-7-5-25/h1-3,8-12H,4-7H2,(H2,23,24,27) |
| InChIKey | LWFLIPYEIPDCST-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.91 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |