C29H37N3O3 — CID 53199021
4-[[N-[1-(1-adamantyl)propan-2-yl]-N'-[(3-methoxyphenyl)methyl]carbamimidoyl]amino]benzoic acid (PubChem CID 53199021) has the molecular formula C29H37N3O3 and a molecular weight of 475.63 g/mol. Its IUPAC name is 4-[[N-[1-(1-adamantyl)propan-2-yl]-N'-[(3-methoxyphenyl)methyl]carbamimidoyl]amino]benzoic acid.
| Compound Name | 4-[[N-[1-(1-adamantyl)propan-2-yl]-N'-[(3-methoxyphenyl)methyl]carbamimidoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 53199021 |
| Molecular Formula | C29H37N3O3 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | 4-[[N-[1-(1-adamantyl)propan-2-yl]-N'-[(3-methoxyphenyl)methyl]carbamimidoyl]amino]benzoic acid |
| SMILES | COc1cccc(C/N=C(\Nc2ccc(C(=O)O)cc2)NC(C)CC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C29H37N3O3/c1-19(14-29-15-21-10-22(16-29)12-23(11-21)17-29)31-28(30-18-20-4-3-5-26(13-20)35-2)32-25-8-6-24(7-9-25)27(33)34/h3-9,13,19,21-23H,10-12,14-18H2,1-2H3,(H,33,34)(H2,30,31,32) |
| InChIKey | NZPWVWKOCKQOMZ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|