C29H34F3N3O4 — CID 146060021
4-[[N'-(1-adamantylmethyl)-N-(2-phenylethyl)carbamimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146060021) has the molecular formula C29H34F3N3O4 and a molecular weight of 545.60 g/mol. Its IUPAC name is 4-[[N'-(1-adamantylmethyl)-N-(2-phenylethyl)carbamimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[N'-(1-adamantylmethyl)-N-(2-phenylethyl)carbamimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146060021 |
| Molecular Formula | C29H34F3N3O4 |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | 4-[[N'-(1-adamantylmethyl)-N-(2-phenylethyl)carbamimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)c1ccc(N/C(=N/CC23CC4CC(CC(C4)C2)C3)NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H33N3O2.C2HF3O2/c31-25(32)23-6-8-24(9-7-23)30-26(28-11-10-19-4-2-1-3-5-19)29-18-27-15-20-12-21(16-27)14-22(13-20)17-27;3-2(4,5)1(6)7/h1-9,20-22H,10-18H2,(H,31,32)(H2,28,29,30);(H,6,7) |
| InChIKey | VPVXTRNAGMVWIE-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|