C28H35N3O3 — CID 53199015
4-[[N'-[2-(1-adamantyloxy)ethyl]-N-(2-phenylethyl)carbamimidoyl]amino]benzoic acid (PubChem CID 53199015) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is 4-[[N'-[2-(1-adamantyloxy)ethyl]-N-(2-phenylethyl)carbamimidoyl]amino]benzoic acid.
| Compound Name | 4-[[N'-[2-(1-adamantyloxy)ethyl]-N-(2-phenylethyl)carbamimidoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 53199015 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | 4-[[N'-[2-(1-adamantyloxy)ethyl]-N-(2-phenylethyl)carbamimidoyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(N/C(=N/CCOC23CC4CC(CC(C4)C2)C3)NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H35N3O3/c32-26(33)24-6-8-25(9-7-24)31-27(29-11-10-20-4-2-1-3-5-20)30-12-13-34-28-17-21-14-22(18-28)16-23(15-21)19-28/h1-9,21-23H,10-19H2,(H,32,33)(H2,29,30,31) |
| InChIKey | YNCONYWHKUGDRB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|