C26H39N3O4 — CID 53199006
4-[[N-[3-(1-adamantyloxy)propyl]-N'-(3-ethoxypropyl)carbamimidoyl]amino]benzoic acid (PubChem CID 53199006) has the molecular formula C26H39N3O4 and a molecular weight of 457.62 g/mol. Its IUPAC name is 4-[[N-[3-(1-adamantyloxy)propyl]-N'-(3-ethoxypropyl)carbamimidoyl]amino]benzoic acid.
| Compound Name | 4-[[N-[3-(1-adamantyloxy)propyl]-N'-(3-ethoxypropyl)carbamimidoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 53199006 |
| Molecular Formula | C26H39N3O4 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.29 |
| IUPAC Name | 4-[[N-[3-(1-adamantyloxy)propyl]-N'-(3-ethoxypropyl)carbamimidoyl]amino]benzoic acid |
| SMILES | CCOCCC/N=C(\NCCCOC12CC3CC(CC(C3)C1)C2)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C26H39N3O4/c1-2-32-11-3-9-27-25(29-23-7-5-22(6-8-23)24(30)31)28-10-4-12-33-26-16-19-13-20(17-26)15-21(14-19)18-26/h5-8,19-21H,2-4,9-18H2,1H3,(H,30,31)(H2,27,28,29) |
| InChIKey | RPABWEDWOOVWIA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|