C28H35N3O2S — CID 53199018
4-[[N'-[2-(1-adamantylsulfanyl)ethyl]-N-(2-phenylethyl)carbamimidoyl]amino]benzoic acid (PubChem CID 53199018) has the molecular formula C28H35N3O2S and a molecular weight of 477.67 g/mol. Its IUPAC name is 4-[[N'-[2-(1-adamantylsulfanyl)ethyl]-N-(2-phenylethyl)carbamimidoyl]amino]benzoic acid.
| Compound Name | 4-[[N'-[2-(1-adamantylsulfanyl)ethyl]-N-(2-phenylethyl)carbamimidoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 53199018 |
| Molecular Formula | C28H35N3O2S |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 4-[[N'-[2-(1-adamantylsulfanyl)ethyl]-N-(2-phenylethyl)carbamimidoyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(N/C(=N/CCSC23CC4CC(CC(C4)C2)C3)NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H35N3O2S/c32-26(33)24-6-8-25(9-7-24)31-27(29-11-10-20-4-2-1-3-5-20)30-12-13-34-28-17-21-14-22(18-28)16-23(15-21)19-28/h1-9,21-23H,10-19H2,(H,32,33)(H2,29,30,31) |
| InChIKey | HYTYKNCCSIWPKG-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|