C22H25N3O3S — CID 53205441
6-ethoxy-2-(4-ethoxyphenyl)-N-(2-methoxyethyl)imidazo[2,1-b][1,3]benzothiazol-1-amine (PubChem CID 53205441) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is 6-ethoxy-2-(4-ethoxyphenyl)-N-(2-methoxyethyl)imidazo[2,1-b][1,3]benzothiazol-1-amine.
| Compound Name | 6-ethoxy-2-(4-ethoxyphenyl)-N-(2-methoxyethyl)imidazo[2,1-b][1,3]benzothiazol-1-amine |
|---|---|
| PubChem CID | 53205441 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 6-ethoxy-2-(4-ethoxyphenyl)-N-(2-methoxyethyl)imidazo[2,1-b][1,3]benzothiazol-1-amine |
| SMILES | CCOc1ccc(-c2nc3sc4cc(OCC)ccc4n3c2NCCOC)cc1 |
| InChI | InChI=1S/C22H25N3O3S/c1-4-27-16-8-6-15(7-9-16)20-21(23-12-13-26-3)25-18-11-10-17(28-5-2)14-19(18)29-22(25)24-20/h6-11,14,23H,4-5,12-13H2,1-3H3 |
| InChIKey | OFPWUKNAMJJANE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 57.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|