C21H23N3O4S — CID 53205387
2-(3,5-dimethoxyphenyl)-6-methoxy-N-(2-methoxyethyl)imidazo[2,1-b][1,3]benzothiazol-1-amine (PubChem CID 53205387) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-6-methoxy-N-(2-methoxyethyl)imidazo[2,1-b][1,3]benzothiazol-1-amine.
| Compound Name | 2-(3,5-dimethoxyphenyl)-6-methoxy-N-(2-methoxyethyl)imidazo[2,1-b][1,3]benzothiazol-1-amine |
|---|---|
| PubChem CID | 53205387 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-6-methoxy-N-(2-methoxyethyl)imidazo[2,1-b][1,3]benzothiazol-1-amine |
| SMILES | COCCNc1c(-c2cc(OC)cc(OC)c2)nc2sc3cc(OC)ccc3n12 |
| InChI | InChI=1S/C21H23N3O4S/c1-25-8-7-22-20-19(13-9-15(27-3)11-16(10-13)28-4)23-21-24(20)17-6-5-14(26-2)12-18(17)29-21/h5-6,9-12,22H,7-8H2,1-4H3 |
| InChIKey | RDZSDWNJKQPMRS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 66.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|