C21H23ClN4OS — CID 53205447
6-chloro-2-[4-(dimethylamino)phenyl]-N-(3-methoxypropyl)imidazo[2,1-b][1,3]benzothiazol-1-amine (PubChem CID 53205447) has the molecular formula C21H23ClN4OS and a molecular weight of 414.96 g/mol. Its IUPAC name is 6-chloro-2-[4-(dimethylamino)phenyl]-N-(3-methoxypropyl)imidazo[2,1-b][1,3]benzothiazol-1-amine.
| Compound Name | 6-chloro-2-[4-(dimethylamino)phenyl]-N-(3-methoxypropyl)imidazo[2,1-b][1,3]benzothiazol-1-amine |
|---|---|
| PubChem CID | 53205447 |
| Molecular Formula | C21H23ClN4OS |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 6-chloro-2-[4-(dimethylamino)phenyl]-N-(3-methoxypropyl)imidazo[2,1-b][1,3]benzothiazol-1-amine |
| SMILES | COCCCNc1c(-c2ccc(N(C)C)cc2)nc2sc3cc(Cl)ccc3n12 |
| InChI | InChI=1S/C21H23ClN4OS/c1-25(2)16-8-5-14(6-9-16)19-20(23-11-4-12-27-3)26-17-10-7-15(22)13-18(17)28-21(26)24-19/h5-10,13,23H,4,11-12H2,1-3H3 |
| InChIKey | SBPRITPGTJWGRR-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 41.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|