C20H21N3O3S — CID 53010642
2-methoxy-4-[1-(3-methoxypropylamino)imidazo[2,1-b][1,3]benzothiazol-2-yl]phenol (PubChem CID 53010642) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is 2-methoxy-4-[1-(3-methoxypropylamino)imidazo[2,1-b][1,3]benzothiazol-2-yl]phenol.
| Compound Name | 2-methoxy-4-[1-(3-methoxypropylamino)imidazo[2,1-b][1,3]benzothiazol-2-yl]phenol |
|---|---|
| PubChem CID | 53010642 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-methoxy-4-[1-(3-methoxypropylamino)imidazo[2,1-b][1,3]benzothiazol-2-yl]phenol |
| SMILES | COCCCNc1c(-c2ccc(O)c(OC)c2)nc2sc3ccccc3n12 |
| InChI | InChI=1S/C20H21N3O3S/c1-25-11-5-10-21-19-18(13-8-9-15(24)16(12-13)26-2)22-20-23(19)14-6-3-4-7-17(14)27-20/h3-4,6-9,12,21,24H,5,10-11H2,1-2H3 |
| InChIKey | FBACLUNVBBNLRD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|