C23H27N3O2S — CID 53205416
2-(2,5-dimethylphenyl)-6-ethoxy-N-(3-methoxypropyl)imidazo[2,1-b][1,3]benzothiazol-1-amine (PubChem CID 53205416) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-6-ethoxy-N-(3-methoxypropyl)imidazo[2,1-b][1,3]benzothiazol-1-amine.
| Compound Name | 2-(2,5-dimethylphenyl)-6-ethoxy-N-(3-methoxypropyl)imidazo[2,1-b][1,3]benzothiazol-1-amine |
|---|---|
| PubChem CID | 53205416 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-6-ethoxy-N-(3-methoxypropyl)imidazo[2,1-b][1,3]benzothiazol-1-amine |
| SMILES | CCOc1ccc2c(c1)sc1nc(-c3cc(C)ccc3C)c(NCCCOC)n12 |
| InChI | InChI=1S/C23H27N3O2S/c1-5-28-17-9-10-19-20(14-17)29-23-25-21(18-13-15(2)7-8-16(18)3)22(26(19)23)24-11-6-12-27-4/h7-10,13-14,24H,5-6,11-12H2,1-4H3 |
| InChIKey | ZQUQDXFLWWAYLF-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 47.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|