C18H18N4O2 — CID 53210235
11-methyl-N-(1-phenylethyl)-10-oxa-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-12-carboxamide (PubChem CID 53210235) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 11-methyl-N-(1-phenylethyl)-10-oxa-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-12-carboxamide.
| Compound Name | 11-methyl-N-(1-phenylethyl)-10-oxa-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-12-carboxamide |
|---|---|
| PubChem CID | 53210235 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 11-methyl-N-(1-phenylethyl)-10-oxa-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-12-carboxamide |
| SMILES | Cc1oc2c(c1C(=O)NC(C)c1ccccc1)C1=NCCN1C=N2 |
| InChI | InChI=1S/C18H18N4O2/c1-11(13-6-4-3-5-7-13)21-17(23)14-12(2)24-18-15(14)16-19-8-9-22(16)10-20-18/h3-7,10-11H,8-9H2,1-2H3,(H,21,23) |
| InChIKey | BLMLALDCHCNOGI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 70.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |