C18H20N4O2S — CID 98129973
11-methyl-N-[(1R)-1-thiophen-2-ylbutyl]-10-oxa-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-12-carboxamide (PubChem CID 98129973) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is 11-methyl-N-[(1R)-1-thiophen-2-ylbutyl]-10-oxa-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-12-carboxamide.
| Compound Name | 11-methyl-N-[(1R)-1-thiophen-2-ylbutyl]-10-oxa-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-12-carboxamide |
|---|---|
| PubChem CID | 98129973 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 11-methyl-N-[(1R)-1-thiophen-2-ylbutyl]-10-oxa-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-12-carboxamide |
| SMILES | CCC[C@@H](NC(=O)c1c(C)oc2c1C1=NCCN1C=N2)c1cccs1 |
| InChI | InChI=1S/C18H20N4O2S/c1-3-5-12(13-6-4-9-25-13)21-17(23)14-11(2)24-18-15(14)16-19-7-8-22(16)10-20-18/h4,6,9-10,12H,3,5,7-8H2,1-2H3,(H,21,23)/t12-/m1/s1 |
| InChIKey | SRXNQOJPOHGYIC-GFCCVEGCSA-N |
| XLogP | 3.66 |
| TPSA | 70.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |