About 7-methyl-5,6-dihydro-4H-thieno[2,3-b]pyridine-2-carboxylic acid
7-methyl-5,6-dihydro-4H-thieno[2,3-b]pyridine-2-carboxylic acid (PubChem CID 53213896) has the molecular formula C9H11NO2S
and a molecular weight of 197.26 g/mol. Its IUPAC name is 7-methyl-5,6-dihydro-4H-thieno[2,3-b]pyridine-2-carboxylic acid.
Analyze 7-methyl-5,6-dihydro-4H-thieno[2,3-b]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-5,6-dihydro-4H-thieno[2,3-b]pyridine-2-carboxylic acid?
The IUPAC name of 7-methyl-5,6-dihydro-4H-thieno[2,3-b]pyridine-2-carboxylic acid (CID 53213896) is 7-methyl-5,6-dihydro-4H-thieno[2,3-b]pyridine-2-carboxylic acid.
What is the SMILES notation for 7-methyl-5,6-dihydro-4H-thieno[2,3-b]pyridine-2-carboxylic acid?
The canonical SMILES for 7-methyl-5,6-dihydro-4H-thieno[2,3-b]pyridine-2-carboxylic acid is CN1CCCc2cc(C(=O)O)sc21.
What is the InChIKey of 7-methyl-5,6-dihydro-4H-thieno[2,3-b]pyridine-2-carboxylic acid?
The InChIKey is HVKGFWTZLAARRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2S/c1-10-4-2-3-6-5-7(9(11)12)13-8(6)10/h5H,2-4H2,1H3,(H,11,12).
What are the key properties of 7-methyl-5,6-dihydro-4H-thieno[2,3-b]pyridine-2-carboxylic acid?
7-methyl-5,6-dihydro-4H-thieno[2,3-b]pyridine-2-carboxylic acid has a molecular weight of 197.26 g/mol, XLogP of 1.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-5,6-dihydro-4H-thieno[2,3-b]pyridine-2-carboxylic acid is sourced from PubChem (CID 53213896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).