C20H24N2O5 — CID 53216035
4-[[3-(1,3-dioxoisoindol-2-yl)butanoylamino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 53216035) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 4-[[3-(1,3-dioxoisoindol-2-yl)butanoylamino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[3-(1,3-dioxoisoindol-2-yl)butanoylamino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 53216035 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 4-[[3-(1,3-dioxoisoindol-2-yl)butanoylamino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | CC(CC(=O)NCC1CCC(C(=O)O)CC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H24N2O5/c1-12(22-18(24)15-4-2-3-5-16(15)19(22)25)10-17(23)21-11-13-6-8-14(9-7-13)20(26)27/h2-5,12-14H,6-11H2,1H3,(H,21,23)(H,26,27) |
| InChIKey | VHRAINCWICOJSM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|