C24H29NO6 — CID 53230425
(4aR,7S,7aS)-4a-hydroxy-2,2-dimethyl-7-phenylmethoxy-5-(2-phenylmethoxyethyl)-7,7a-dihydro-4H-[1,3]dioxino[5,4-b]pyrrol-6-one (PubChem CID 53230425) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is (4aR,7S,7aS)-4a-hydroxy-2,2-dimethyl-7-phenylmethoxy-5-(2-phenylmethoxyethyl)-7,7a-dihydro-4H-[1,3]dioxino[5,4-b]pyrrol-6-one.
| Compound Name | (4aR,7S,7aS)-4a-hydroxy-2,2-dimethyl-7-phenylmethoxy-5-(2-phenylmethoxyethyl)-7,7a-dihydro-4H-[1,3]dioxino[5,4-b]pyrrol-6-one |
|---|---|
| PubChem CID | 53230425 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | (4aR,7S,7aS)-4a-hydroxy-2,2-dimethyl-7-phenylmethoxy-5-(2-phenylmethoxyethyl)-7,7a-dihydro-4H-[1,3]dioxino[5,4-b]pyrrol-6-one |
| SMILES | CC1(C)OC[C@@]2(O)[C@@H](O1)[C@H](OCc1ccccc1)C(=O)N2CCOCc1ccccc1 |
| InChI | InChI=1S/C24H29NO6/c1-23(2)30-17-24(27)21(31-23)20(29-16-19-11-7-4-8-12-19)22(26)25(24)13-14-28-15-18-9-5-3-6-10-18/h3-12,20-21,27H,13-17H2,1-2H3/t20-,21-,24+/m0/s1 |
| InChIKey | IUYMMFVOMWDGLA-AWRGLXIESA-N |
| XLogP | 2.47 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|