C27H36O7 — CID 102380012
(4aR,6R,7R,8R,8aS)-2,2-dimethyl-8-phenylmethoxy-4a-(phenylmethoxymethyl)-6-propan-2-yloxy-6,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 102380012) has the molecular formula C27H36O7 and a molecular weight of 472.58 g/mol. Its IUPAC name is (4aR,6R,7R,8R,8aS)-2,2-dimethyl-8-phenylmethoxy-4a-(phenylmethoxymethyl)-6-propan-2-yloxy-6,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (4aR,6R,7R,8R,8aS)-2,2-dimethyl-8-phenylmethoxy-4a-(phenylmethoxymethyl)-6-propan-2-yloxy-6,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 102380012 |
| Molecular Formula | C27H36O7 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | (4aR,6R,7R,8R,8aS)-2,2-dimethyl-8-phenylmethoxy-4a-(phenylmethoxymethyl)-6-propan-2-yloxy-6,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | CC(C)O[C@@H]1O[C@]2(COCc3ccccc3)COC(C)(C)O[C@H]2[C@H](OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C27H36O7/c1-19(2)32-25-22(28)23(30-16-21-13-9-6-10-14-21)24-27(34-25,18-31-26(3,4)33-24)17-29-15-20-11-7-5-8-12-20/h5-14,19,22-25,28H,15-18H2,1-4H3/t22-,23-,24+,25-,27-/m1/s1 |
| InChIKey | LYJRDCWTJSGPKX-ZANOAUCBSA-N |
| XLogP | 3.82 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |