C20H40O4Si — CID 53230773
(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4S,5R)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde (PubChem CID 53230773) has the molecular formula C20H40O4Si and a molecular weight of 372.62 g/mol. Its IUPAC name is (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4S,5R)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde.
| Compound Name | (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4S,5R)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 53230773 |
| Molecular Formula | C20H40O4Si |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4S,5R)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde |
| SMILES | CCCCCCC[C@H]1OC(C)(C)O[C@@H]1[C@H](C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O4Si/c1-9-10-11-12-13-14-16-18(23-20(5,6)22-16)17(15-21)24-25(7,8)19(2,3)4/h15-18H,9-14H2,1-8H3/t16-,17+,18+/m1/s1 |
| InChIKey | SXFDTGZVPZAHQR-SQNIBIBYSA-N |
| XLogP | 5.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|