C15H21NO3S — CID 53231494
N-[(4-methoxycyclohex-3-en-1-yl)methyl]-4-methylbenzenesulfonamide (PubChem CID 53231494) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is N-[(4-methoxycyclohex-3-en-1-yl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(4-methoxycyclohex-3-en-1-yl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 53231494 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N-[(4-methoxycyclohex-3-en-1-yl)methyl]-4-methylbenzenesulfonamide |
| SMILES | COC1=CCC(CNS(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C15H21NO3S/c1-12-3-9-15(10-4-12)20(17,18)16-11-13-5-7-14(19-2)8-6-13/h3-4,7,9-10,13,16H,5-6,8,11H2,1-2H3 |
| InChIKey | SJVNSSKNQPPXNG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |