C22H18N2O5S — CID 53232118
(5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-3-[(7-hydroxy-2-oxochromen-4-yl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 53232118) has the molecular formula C22H18N2O5S and a molecular weight of 422.46 g/mol. Its IUPAC name is (5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-3-[(7-hydroxy-2-oxochromen-4-yl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-3-[(7-hydroxy-2-oxochromen-4-yl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 53232118 |
| Molecular Formula | C22H18N2O5S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | (5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-3-[(7-hydroxy-2-oxochromen-4-yl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CN(C)c1ccc(/C=C2\SC(=O)N(Cc3cc(=O)oc4cc(O)ccc34)C2=O)cc1 |
| InChI | InChI=1S/C22H18N2O5S/c1-23(2)15-5-3-13(4-6-15)9-19-21(27)24(22(28)30-19)12-14-10-20(26)29-18-11-16(25)7-8-17(14)18/h3-11,25H,12H2,1-2H3/b19-9- |
| InChIKey | JOEDFZABNULHBK-OCKHKDLRSA-N |
| XLogP | 3.80 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|