C20H11Cl2NO4S — CID 155812185
(5Z)-3-[(6-chloro-2-oxochromen-4-yl)methyl]-5-[(4-chlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 155812185) has the molecular formula C20H11Cl2NO4S and a molecular weight of 432.28 g/mol. Its IUPAC name is (5Z)-3-[(6-chloro-2-oxochromen-4-yl)methyl]-5-[(4-chlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[(6-chloro-2-oxochromen-4-yl)methyl]-5-[(4-chlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 155812185 |
| Molecular Formula | C20H11Cl2NO4S |
| Molecular Weight | 432.28 g/mol |
| Exact Mass | 430.98 |
| IUPAC Name | (5Z)-3-[(6-chloro-2-oxochromen-4-yl)methyl]-5-[(4-chlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2ccc(Cl)cc2)C(=O)N1Cc1cc(=O)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C20H11Cl2NO4S/c21-13-3-1-11(2-4-13)7-17-19(25)23(20(26)28-17)10-12-8-18(24)27-16-6-5-14(22)9-15(12)16/h1-9H,10H2/b17-7- |
| InChIKey | KANARXPJKBHCMU-IDUWFGFVSA-N |
| XLogP | 5.34 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.28 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|