C20H12BrNO5S — CID 53232115
(5Z)-5-[(3-bromophenyl)methylidene]-3-[(7-hydroxy-2-oxochromen-4-yl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 53232115) has the molecular formula C20H12BrNO5S and a molecular weight of 458.29 g/mol. Its IUPAC name is (5Z)-5-[(3-bromophenyl)methylidene]-3-[(7-hydroxy-2-oxochromen-4-yl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(3-bromophenyl)methylidene]-3-[(7-hydroxy-2-oxochromen-4-yl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 53232115 |
| Molecular Formula | C20H12BrNO5S |
| Molecular Weight | 458.29 g/mol |
| Exact Mass | 456.96 |
| IUPAC Name | (5Z)-5-[(3-bromophenyl)methylidene]-3-[(7-hydroxy-2-oxochromen-4-yl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2cccc(Br)c2)C(=O)N1Cc1cc(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C20H12BrNO5S/c21-13-3-1-2-11(6-13)7-17-19(25)22(20(26)28-17)10-12-8-18(24)27-16-9-14(23)4-5-15(12)16/h1-9,23H,10H2/b17-7- |
| InChIKey | GJQRGXNEMVXERK-IDUWFGFVSA-N |
| XLogP | 4.50 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.29 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|